C11H12N2O3 — CID 91560040
carbamoyl 1,2,3,4-tetrahydroisoquinoline-7-carboxylate (PubChem CID 91560040) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is carbamoyl 1,2,3,4-tetrahydroisoquinoline-7-carboxylate.
| Compound Name | carbamoyl 1,2,3,4-tetrahydroisoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 91560040 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | carbamoyl 1,2,3,4-tetrahydroisoquinoline-7-carboxylate |
| SMILES | NC(=O)OC(=O)c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C11H12N2O3/c12-11(15)16-10(14)8-2-1-7-3-4-13-6-9(7)5-8/h1-2,5,13H,3-4,6H2,(H2,12,15) |
| InChIKey | SQTWYPHUOSVBMT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|