C18H19NO3 — CID 140712102
2-[(1R)-6-(2-hydroxyethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 140712102) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[(1R)-6-(2-hydroxyethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 2-[(1R)-6-(2-hydroxyethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 140712102 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[(1R)-6-(2-hydroxyethoxy)-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | NC(=O)c1ccccc1[C@@H]1CCc2ccc(OCCO)cc21 |
| InChI | InChI=1S/C18H19NO3/c19-18(21)16-4-2-1-3-14(16)15-8-6-12-5-7-13(11-17(12)15)22-10-9-20/h1-5,7,11,15,20H,6,8-10H2,(H2,19,21)/t15-/m0/s1 |
| InChIKey | BUEAHWKEQHVNEG-HNNXBMFYSA-N |
| XLogP | 2.23 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |