C23H25NO4 — CID 140554253
2-[(2S)-6-formyl-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide (PubChem CID 140554253) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[(2S)-6-formyl-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | 2-[(2S)-6-formyl-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 140554253 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[(2S)-6-formyl-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
| SMILES | NC(=O)c1ccc(OC[C@@H]2CCCO2)cc1[C@H]1CCc2cc(C=O)ccc2C1 |
| InChI | InChI=1S/C23H25NO4/c24-23(26)21-8-7-19(28-14-20-2-1-9-27-20)12-22(21)18-6-5-16-10-15(13-25)3-4-17(16)11-18/h3-4,7-8,10,12-13,18,20H,1-2,5-6,9,11,14H2,(H2,24,26)/t18-,20-/m0/s1 |
| InChIKey | JTTWRNOYQZWLFE-ICSRJNTNSA-N |
| XLogP | 3.43 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|