C30H42N2O3 — CID 67545819
N-[6-[2-(2,2-dimethylpropylamino)propan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 67545819) has the molecular formula C30H42N2O3 and a molecular weight of 478.68 g/mol. Its IUPAC name is N-[6-[2-(2,2-dimethylpropylamino)propan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[6-[2-(2,2-dimethylpropylamino)propan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 67545819 |
| Molecular Formula | C30H42N2O3 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | N-[6-[2-(2,2-dimethylpropylamino)propan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | CC(C)(C)CNC(C)(C)c1ccc2c(c1)CCC(NC(=O)c1ccc(OCC3CCCO3)cc1)C2 |
| InChI | InChI=1S/C30H42N2O3/c1-29(2,3)20-31-30(4,5)24-12-8-23-18-25(13-9-22(23)17-24)32-28(33)21-10-14-26(15-11-21)35-19-27-7-6-16-34-27/h8,10-12,14-15,17,25,27,31H,6-7,9,13,16,18-20H2,1-5H3,(H,32,33) |
| InChIKey | XBFVIKXXHVPELL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |