C31H36N2O4 — CID 59505861
4-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-6-[(2-phenoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 59505861) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-6-[(2-phenoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-6-[(2-phenoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 59505861 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[(2S)-6-[(2-phenoxyethylamino)methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | O=C(N[C@H]1CCc2cc(CNCCOc3ccccc3)ccc2C1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C31H36N2O4/c34-31(24-11-14-29(15-12-24)37-22-30-7-4-17-35-30)33-27-13-10-25-19-23(8-9-26(25)20-27)21-32-16-18-36-28-5-2-1-3-6-28/h1-3,5-6,8-9,11-12,14-15,19,27,30,32H,4,7,10,13,16-18,20-22H2,(H,33,34)/t27-,30-/m0/s1 |
| InChIKey | MTKMSLPEZBBOES-FIBWVYCGSA-N |
| XLogP | 4.70 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|