C30H38N2O3 — CID 25190355
N-[(2S)-6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide (PubChem CID 25190355) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[(2S)-6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-[(2S)-6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 25190355 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | N-[(2S)-6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
| SMILES | O=C(N[C@H]1CCc2cc(CN3CC4CCCC4C3)ccc2C1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C30H38N2O3/c33-30(22-9-12-28(13-10-22)35-20-29-5-2-14-34-29)31-27-11-8-23-15-21(6-7-24(23)16-27)17-32-18-25-3-1-4-26(25)19-32/h6-7,9-10,12-13,15,25-27,29H,1-5,8,11,14,16-20H2,(H,31,33)/t25?,26?,27-,29-/m0/s1 |
| InChIKey | QVSDSJIIFJMEHY-XELBMSLBSA-N |
| XLogP | 4.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |