C32H42N2O3 — CID 59505832
N-[(2S)-6-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide (PubChem CID 59505832) has the molecular formula C32H42N2O3 and a molecular weight of 502.70 g/mol. Its IUPAC name is N-[(2S)-6-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-[(2S)-6-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 59505832 |
| Molecular Formula | C32H42N2O3 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | N-[(2S)-6-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
| SMILES | O=C(N[C@H]1CCc2cc(CN3CC[C@H]4CCCC[C@@H]4C3)ccc2C1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C32H42N2O3/c35-32(25-10-13-30(14-11-25)37-22-31-6-3-17-36-31)33-29-12-9-26-18-23(7-8-27(26)19-29)20-34-16-15-24-4-1-2-5-28(24)21-34/h7-8,10-11,13-14,18,24,28-29,31H,1-6,9,12,15-17,19-22H2,(H,33,35)/t24-,28-,29+,31+/m1/s1 |
| InChIKey | OQMBHKBYLRYPDB-VXKPSODKSA-N |
| XLogP | 5.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |