C14H15F3O3S — CID 124564880
(2S)-2-cyclopentylsulfanyl-2-[4-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 124564880) has the molecular formula C14H15F3O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is (2S)-2-cyclopentylsulfanyl-2-[4-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | (2S)-2-cyclopentylsulfanyl-2-[4-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 124564880 |
| Molecular Formula | C14H15F3O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (2S)-2-cyclopentylsulfanyl-2-[4-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)[C@@H](SC1CCCC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3O3S/c15-14(16,17)20-10-7-5-9(6-8-10)12(13(18)19)21-11-3-1-2-4-11/h5-8,11-12H,1-4H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | WVVAIAOOILGDCL-LBPRGKRZSA-N |
| XLogP | 4.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |