C19H20F3N3O4 — CID 155746338
ethyl (E)-3-amino-2-hydrazinyl-3-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methoxy]prop-2-enoate (PubChem CID 155746338) has the molecular formula C19H20F3N3O4 and a molecular weight of 411.38 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-hydrazinyl-3-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methoxy]prop-2-enoate.
| Compound Name | ethyl (E)-3-amino-2-hydrazinyl-3-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methoxy]prop-2-enoate |
|---|---|
| PubChem CID | 155746338 |
| Molecular Formula | C19H20F3N3O4 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl (E)-3-amino-2-hydrazinyl-3-[[4-[4-(trifluoromethoxy)phenyl]phenyl]methoxy]prop-2-enoate |
| SMILES | CCOC(=O)/C(NN)=C(/N)OCc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H20F3N3O4/c1-2-27-18(26)16(25-24)17(23)28-11-12-3-5-13(6-4-12)14-7-9-15(10-8-14)29-19(20,21)22/h3-10,25H,2,11,23-24H2,1H3/b17-16+ |
| InChIKey | WETILLUKVULTBX-WUKNDPDISA-N |
| XLogP | 2.92 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|