C20H15F4N2O3+ — CID 156761563
[4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl] N-pyridin-1-ium-1-ylcarbamate (PubChem CID 156761563) has the molecular formula C20H15F4N2O3+ and a molecular weight of 407.34 g/mol. Its IUPAC name is [4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl] N-pyridin-1-ium-1-ylcarbamate.
| Compound Name | [4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl] N-pyridin-1-ium-1-ylcarbamate |
|---|---|
| PubChem CID | 156761563 |
| Molecular Formula | C20H15F4N2O3+ |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]phenyl] N-pyridin-1-ium-1-ylcarbamate |
| SMILES | O=C(N[n+]1ccccc1)Oc1ccc(-c2ccc(OC(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H14F4N2O3/c21-18(22)20(23,24)29-17-10-6-15(7-11-17)14-4-8-16(9-5-14)28-19(27)25-26-12-2-1-3-13-26/h1-13,18H/p+1 |
| InChIKey | PSYALZJQMPDHCI-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|