C17H11F10N2O3+ — CID 164929070
N-pyridin-1-ium-1-yl-4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzamide (PubChem CID 164929070) has the molecular formula C17H11F10N2O3+ and a molecular weight of 481.27 g/mol. Its IUPAC name is N-pyridin-1-ium-1-yl-4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzamide.
| Compound Name | N-pyridin-1-ium-1-yl-4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzamide |
|---|---|
| PubChem CID | 164929070 |
| Molecular Formula | C17H11F10N2O3+ |
| Molecular Weight | 481.27 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | N-pyridin-1-ium-1-yl-4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]benzamide |
| SMILES | O=C(N[n+]1ccccc1)c1ccc(OC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F10N2O3/c18-13(32-17(26,27)15(21,22)16(23,24)25)14(19,20)31-11-6-4-10(5-7-11)12(30)28-29-8-2-1-3-9-29/h1-9,13H/p+1 |
| InChIKey | KTDZUGZSIIZHRD-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|