C20H11F10N3O3 — CID 167617746
N-pyrazin-1-ium-1-yl-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboximidate (PubChem CID 167617746) has the molecular formula C20H11F10N3O3 and a molecular weight of 531.31 g/mol. Its IUPAC name is N-pyrazin-1-ium-1-yl-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboximidate.
| Compound Name | N-pyrazin-1-ium-1-yl-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboximidate |
|---|---|
| PubChem CID | 167617746 |
| Molecular Formula | C20H11F10N3O3 |
| Molecular Weight | 531.31 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | N-pyrazin-1-ium-1-yl-6-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]naphthalene-2-carboximidate |
| SMILES | [O-]C(=N[n+]1ccncc1)c1ccc2cc(OC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C20H11F10N3O3/c21-16(36-20(29,30)18(24,25)19(26,27)28)17(22,23)35-14-4-3-11-9-13(2-1-12(11)10-14)15(34)32-33-7-5-31-6-8-33/h1-10,16H |
| InChIKey | LZLLHAXNZXMIBM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|