C17H10F9N5O2 — CID 166006309
(3Z)-5-cyano-2-methyl-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyrazin-1-ium-1-ylpyridine-3-carboximidate (PubChem CID 166006309) has the molecular formula C17H10F9N5O2 and a molecular weight of 487.28 g/mol. Its IUPAC name is (3Z)-5-cyano-2-methyl-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyrazin-1-ium-1-ylpyridine-3-carboximidate.
| Compound Name | (3Z)-5-cyano-2-methyl-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyrazin-1-ium-1-ylpyridine-3-carboximidate |
|---|---|
| PubChem CID | 166006309 |
| Molecular Formula | C17H10F9N5O2 |
| Molecular Weight | 487.28 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (3Z)-5-cyano-2-methyl-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyrazin-1-ium-1-ylpyridine-3-carboximidate |
| SMILES | Cc1nc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C#N)cc1/C([O-])=N/[n+]1ccncc1 |
| InChI | InChI=1S/C17H10F9N5O2/c1-9-11(12(32)30-31-4-2-28-3-5-31)6-10(7-27)13(29-9)33-8-14(18,19)15(20,21)16(22,23)17(24,25)26/h2-6H,8H2,1H3 |
| InChIKey | YNRCRVDXCCQBBO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 98.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|