C13H6ClF11O3 — CID 54355557
3-chloro-4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)benzoic acid (PubChem CID 54355557) has the molecular formula C13H6ClF11O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is 3-chloro-4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)benzoic acid.
| Compound Name | 3-chloro-4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)benzoic acid |
|---|---|
| PubChem CID | 54355557 |
| Molecular Formula | C13H6ClF11O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 3-chloro-4-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H6ClF11O3/c14-6-3-5(8(26)27)1-2-7(6)28-4-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)25/h1-3H,4H2,(H,26,27) |
| InChIKey | UIWAGXMCXHCQLU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|