C11H5F9N2O — CID 167152493
2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine-3-carbonitrile (PubChem CID 167152493) has the molecular formula C11H5F9N2O and a molecular weight of 352.16 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine-3-carbonitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167152493 |
| Molecular Formula | C11H5F9N2O |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F9N2O/c12-8(13,9(14,15)10(16,17)11(18,19)20)5-23-7-6(4-21)2-1-3-22-7/h1-3H,5H2 |
| InChIKey | SOXIPTKGFPKOJC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|