C9H10N2O3 — CID 12529033
2-(2,3-dihydroxypropoxy)pyridine-3-carbonitrile (PubChem CID 12529033) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)pyridine-3-carbonitrile.
| Compound Name | 2-(2,3-dihydroxypropoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12529033 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-(2,3-dihydroxypropoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1OCC(O)CO |
| InChI | InChI=1S/C9H10N2O3/c10-4-7-2-1-3-11-9(7)14-6-8(13)5-12/h1-3,8,12-13H,5-6H2 |
| InChIKey | QQYMMUCTBIRPQK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |