C8H12N2O5S — CID 86115167
2-(2,3-dihydroxypropoxy)pyridine-3-sulfonamide (PubChem CID 86115167) has the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)pyridine-3-sulfonamide.
| Compound Name | 2-(2,3-dihydroxypropoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 86115167 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(2,3-dihydroxypropoxy)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cccnc1OCC(O)CO |
| InChI | InChI=1S/C8H12N2O5S/c9-16(13,14)7-2-1-3-10-8(7)15-5-6(12)4-11/h1-3,6,11-12H,4-5H2,(H2,9,13,14) |
| InChIKey | DYMRPAYQYWDUHQ-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |