C10H5ClF9NO — CID 167152496
3-chloro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine (PubChem CID 167152496) has the molecular formula C10H5ClF9NO and a molecular weight of 361.59 g/mol. Its IUPAC name is 3-chloro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine.
| Compound Name | 3-chloro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine |
|---|---|
| PubChem CID | 167152496 |
| Molecular Formula | C10H5ClF9NO |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 3-chloro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)pyridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)COc1ncccc1Cl |
| InChI | InChI=1S/C10H5ClF9NO/c11-5-2-1-3-21-6(5)22-4-7(12,13)8(14,15)9(16,17)10(18,19)20/h1-3H,4H2 |
| InChIKey | BRKIEYWSJKJEBL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|