C28H12F26N4O2 — CID 176747311
2-(4-pyridin-2-ylphenyl)-4,6-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-1,3,5-triazine (PubChem CID 176747311) has the molecular formula C28H12F26N4O2 and a molecular weight of 930.38 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylphenyl)-4,6-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-1,3,5-triazine.
| Compound Name | 2-(4-pyridin-2-ylphenyl)-4,6-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 176747311 |
| Molecular Formula | C28H12F26N4O2 |
| Molecular Weight | 930.38 g/mol |
| Exact Mass | 930.05 |
| IUPAC Name | 2-(4-pyridin-2-ylphenyl)-4,6-bis(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)-1,3,5-triazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COc1nc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(-c2ccc(-c3ccccn3)cc2)n1 |
| InChI | InChI=1S/C28H12F26N4O2/c29-17(30,19(33,34)21(37,38)23(41,42)25(45,46)27(49,50)51)9-59-15-56-14(12-6-4-11(5-7-12)13-3-1-2-8-55-13)57-16(58-15)60-10-18(31,32)20(35,36)22(39,40)24(43,44)26(47,48)28(52,53)54/h1-8H,9-10H2 |
| InChIKey | INKARHDFDZXDRU-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.38 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|