C10H4F7N3O — CID 15274998
(1Z)-N-(4-cyanopyridin-1-ium-1-yl)-2,2,3,3,4,4,4-heptafluorobutanimidate (PubChem CID 15274998) has the molecular formula C10H4F7N3O and a molecular weight of 315.15 g/mol. Its IUPAC name is (1Z)-N-(4-cyanopyridin-1-ium-1-yl)-2,2,3,3,4,4,4-heptafluorobutanimidate.
| Compound Name | (1Z)-N-(4-cyanopyridin-1-ium-1-yl)-2,2,3,3,4,4,4-heptafluorobutanimidate |
|---|---|
| PubChem CID | 15274998 |
| Molecular Formula | C10H4F7N3O |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | (1Z)-N-(4-cyanopyridin-1-ium-1-yl)-2,2,3,3,4,4,4-heptafluorobutanimidate |
| SMILES | N#Cc1cc[n+](/N=C(\[O-])C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H4F7N3O/c11-8(12,9(13,14)10(15,16)17)7(21)19-20-3-1-6(5-18)2-4-20/h1-4H |
| InChIKey | BBCLJNHNDMXLFG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|