C13H5F12N — CID 139245514
4-[1,3,3,4,4,4-hexafluoro-2,2-bis(trifluoromethyl)butyl]benzonitrile (PubChem CID 139245514) has the molecular formula C13H5F12N and a molecular weight of 403.17 g/mol. Its IUPAC name is 4-[1,3,3,4,4,4-hexafluoro-2,2-bis(trifluoromethyl)butyl]benzonitrile.
| Compound Name | 4-[1,3,3,4,4,4-hexafluoro-2,2-bis(trifluoromethyl)butyl]benzonitrile |
|---|---|
| PubChem CID | 139245514 |
| Molecular Formula | C13H5F12N |
| Molecular Weight | 403.17 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 4-[1,3,3,4,4,4-hexafluoro-2,2-bis(trifluoromethyl)butyl]benzonitrile |
| SMILES | N#Cc1ccc(C(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H5F12N/c14-8(7-3-1-6(5-26)2-4-7)9(11(17,18)19,12(20,21)22)10(15,16)13(23,24)25/h1-4,8H |
| InChIKey | NJIQZWYEUXTMGL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.17 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|