C10H10F2N2 — CID 131626102
4-[(1R)-1-amino-3,3-difluoropropyl]benzonitrile (PubChem CID 131626102) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 4-[(1R)-1-amino-3,3-difluoropropyl]benzonitrile.
| Compound Name | 4-[(1R)-1-amino-3,3-difluoropropyl]benzonitrile |
|---|---|
| PubChem CID | 131626102 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-[(1R)-1-amino-3,3-difluoropropyl]benzonitrile |
| SMILES | N#Cc1ccc([C@H](N)CC(F)F)cc1 |
| InChI | InChI=1S/C10H10F2N2/c11-10(12)5-9(14)8-3-1-7(6-13)2-4-8/h1-4,9-10H,5,14H2/t9-/m1/s1 |
| InChIKey | MKBSRSRVBXRRGF-SECBINFHSA-N |
| XLogP | 2.21 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |