C11H16ClN3 — CID 171217680
4-[(1S)-1,4-diaminobutyl]benzonitrile;hydrochloride (PubChem CID 171217680) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 4-[(1S)-1,4-diaminobutyl]benzonitrile;hydrochloride.
| Compound Name | 4-[(1S)-1,4-diaminobutyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171217680 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-[(1S)-1,4-diaminobutyl]benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc([C@@H](N)CCCN)cc1 |
| InChI | InChI=1S/C11H15N3.ClH/c12-7-1-2-11(14)10-5-3-9(8-13)4-6-10;/h3-6,11H,1-2,7,12,14H2;1H/t11-;/m0./s1 |
| InChIKey | RJYWTMCQQLDLFI-MERQFXBCSA-N |
| XLogP | 1.72 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |