C11H19N3 — CID 66819791
1-[4-(methylamino)phenyl]butane-1,4-diamine (PubChem CID 66819791) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[4-(methylamino)phenyl]butane-1,4-diamine.
| Compound Name | 1-[4-(methylamino)phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 66819791 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-[4-(methylamino)phenyl]butane-1,4-diamine |
| SMILES | CNc1ccc(C(N)CCCN)cc1 |
| InChI | InChI=1S/C11H19N3/c1-14-10-6-4-9(5-7-10)11(13)3-2-8-12/h4-7,11,14H,2-3,8,12-13H2,1H3 |
| InChIKey | XPHGCUUNVPGIPP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |