C12H21ClN2O — CID 171220228
(1S)-1-(4-ethoxyphenyl)butane-1,4-diamine;hydrochloride (PubChem CID 171220228) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is (1S)-1-(4-ethoxyphenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(4-ethoxyphenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171220228 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (1S)-1-(4-ethoxyphenyl)butane-1,4-diamine;hydrochloride |
| SMILES | CCOc1ccc([C@@H](N)CCCN)cc1.Cl |
| InChI | InChI=1S/C12H20N2O.ClH/c1-2-15-11-7-5-10(6-8-11)12(14)4-3-9-13;/h5-8,12H,2-4,9,13-14H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | BOILVTXOIFFJGA-YDALLXLXSA-N |
| XLogP | 2.25 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |