C13H22N2O — CID 112517875
1-(4-ethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 112517875) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | 1-(4-ethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 112517875 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(4-ethoxyphenyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCOc1ccc(C(N)CCN(C)C)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-4-16-12-7-5-11(6-8-12)13(14)9-10-15(2)3/h5-8,13H,4,9-10,14H2,1-3H3 |
| InChIKey | CSUYQANTYFKLRZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |