C13H22N2O — CID 116933717
1-(4-ethoxy-3-methylphenyl)butane-1,4-diamine (PubChem CID 116933717) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-(4-ethoxy-3-methylphenyl)butane-1,4-diamine.
| Compound Name | 1-(4-ethoxy-3-methylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116933717 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-(4-ethoxy-3-methylphenyl)butane-1,4-diamine |
| SMILES | CCOc1ccc(C(N)CCCN)cc1C |
| InChI | InChI=1S/C13H22N2O/c1-3-16-13-7-6-11(9-10(13)2)12(15)5-4-8-14/h6-7,9,12H,3-5,8,14-15H2,1-2H3 |
| InChIKey | JBADEOLUWXIYOM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |