C12H20N2O — CID 116932779
1-(4-ethoxy-3-methylphenyl)propane-1,3-diamine (PubChem CID 116932779) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(4-ethoxy-3-methylphenyl)propane-1,3-diamine.
| Compound Name | 1-(4-ethoxy-3-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116932779 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(4-ethoxy-3-methylphenyl)propane-1,3-diamine |
| SMILES | CCOc1ccc(C(N)CCN)cc1C |
| InChI | InChI=1S/C12H20N2O/c1-3-15-12-5-4-10(8-9(12)2)11(14)6-7-13/h4-5,8,11H,3,6-7,13-14H2,1-2H3 |
| InChIKey | FYNSGBAFRJASNG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |