C12H4F11N — CID 139653198
4-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]benzonitrile (PubChem CID 139653198) has the molecular formula C12H4F11N and a molecular weight of 371.15 g/mol. Its IUPAC name is 4-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]benzonitrile.
| Compound Name | 4-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]benzonitrile |
|---|---|
| PubChem CID | 139653198 |
| Molecular Formula | C12H4F11N |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 4-[1,1,2,2,3,4,4,4-octafluoro-3-(trifluoromethyl)butyl]benzonitrile |
| SMILES | N#Cc1ccc(C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H4F11N/c13-8(14,7-3-1-6(5-24)2-4-7)10(16,17)9(15,11(18,19)20)12(21,22)23/h1-4H |
| InChIKey | BYCKUHPBILZOOW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|