C16H10F3NO — CID 11185356
4-[(2S,3S)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]benzonitrile (PubChem CID 11185356) has the molecular formula C16H10F3NO and a molecular weight of 289.26 g/mol. Its IUPAC name is 4-[(2S,3S)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]benzonitrile.
| Compound Name | 4-[(2S,3S)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]benzonitrile |
|---|---|
| PubChem CID | 11185356 |
| Molecular Formula | C16H10F3NO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[(2S,3S)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2O[C@H]2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H10F3NO/c17-16(18,19)13-7-5-12(6-8-13)15-14(21-15)11-3-1-10(9-20)2-4-11/h1-8,14-15H/t14-,15-/m0/s1 |
| InChIKey | DHEZJADQWJMCLN-GJZGRUSLSA-N |
| XLogP | 4.39 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|