C19H18F3N3 — CID 150713631
4-[4-methyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]benzonitrile (PubChem CID 150713631) has the molecular formula C19H18F3N3 and a molecular weight of 345.37 g/mol. Its IUPAC name is 4-[4-methyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-methyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 150713631 |
| Molecular Formula | C19H18F3N3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-[4-methyl-3-[4-(trifluoromethyl)phenyl]piperazin-1-yl]benzonitrile |
| SMILES | CN1CCN(c2ccc(C#N)cc2)CC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3/c1-24-10-11-25(17-8-2-14(12-23)3-9-17)13-18(24)15-4-6-16(7-5-15)19(20,21)22/h2-9,18H,10-11,13H2,1H3 |
| InChIKey | JOKJYOJNTUOYKF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |