About 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide
1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide (PubChem CID 156774157) has the molecular formula C22H22F3N3O
and a molecular weight of 401.43 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide |
| PubChem CID | 156774157 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCC(c2ccc(C(F)(F)F)cc2)CN1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H22F3N3O/c1-27(2)21(29)20-12-7-17(16-5-8-18(9-6-16)22(23,24)25)14-28(20)19-10-3-15(13-26)4-11-19/h3-6,8-11,17,20H,7,12,14H2,1-2H3 |
| InChIKey | LYBXJJDSGNJQIL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide?
The IUPAC name of 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide (CID 156774157) is 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide.
What is the SMILES notation for 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide?
The canonical SMILES for 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide is CN(C)C(=O)C1CCC(c2ccc(C(F)(F)F)cc2)CN1c1ccc(C#N)cc1.
What is the InChIKey of 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide?
The InChIKey is LYBXJJDSGNJQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F3N3O/c1-27(2)21(29)20-12-7-17(16-5-8-18(9-6-16)22(23,24)25)14-28(20)19-10-3-15(13-26)4-11-19/h3-6,8-11,17,20H,7,12,14H2,1-2H3.
What are the key properties of 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide?
1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide has a molecular weight of 401.43 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyanophenyl)-N,N-dimethyl-5-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide is sourced from PubChem (CID 156774157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).