C24H28F3NO3 — CID 146295368
4-[(2S)-2-(butoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]benzoic acid (PubChem CID 146295368) has the molecular formula C24H28F3NO3 and a molecular weight of 435.49 g/mol. Its IUPAC name is 4-[(2S)-2-(butoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]benzoic acid.
| Compound Name | 4-[(2S)-2-(butoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 146295368 |
| Molecular Formula | C24H28F3NO3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 4-[(2S)-2-(butoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-1-yl]benzoic acid |
| SMILES | CCCCOC[C@@H]1CCC(c2ccc(C(F)(F)F)cc2)CN1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H28F3NO3/c1-2-3-14-31-16-22-13-8-19(17-4-9-20(10-5-17)24(25,26)27)15-28(22)21-11-6-18(7-12-21)23(29)30/h4-7,9-12,19,22H,2-3,8,13-16H2,1H3,(H,29,30)/t19?,22-/m0/s1 |
| InChIKey | YSFGDYBTIRQLJJ-BPARTEKVSA-N |
| XLogP | 5.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|