C31H32F3N3O4S — CID 146298158
4-[(2S)-2-(2-cyanoethoxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-N-[(4-ethylsulfonylphenyl)methyl]benzamide (PubChem CID 146298158) has the molecular formula C31H32F3N3O4S and a molecular weight of 599.68 g/mol. Its IUPAC name is 4-[(2S)-2-(2-cyanoethoxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-N-[(4-ethylsulfonylphenyl)methyl]benzamide.
| Compound Name | 4-[(2S)-2-(2-cyanoethoxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-N-[(4-ethylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 146298158 |
| Molecular Formula | C31H32F3N3O4S |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | 4-[(2S)-2-(2-cyanoethoxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-N-[(4-ethylsulfonylphenyl)methyl]benzamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)c2ccc(N3CC(c4ccc(C(F)(F)F)cc4)C[C@H]3COCCC#N)cc2)cc1 |
| InChI | InChI=1S/C31H32F3N3O4S/c1-2-42(39,40)29-14-4-22(5-15-29)19-36-30(38)24-8-12-27(13-9-24)37-20-25(18-28(37)21-41-17-3-16-35)23-6-10-26(11-7-23)31(32,33)34/h4-15,25,28H,2-3,17-21H2,1H3,(H,36,38)/t25?,28-/m0/s1 |
| InChIKey | NBVQNWUDBYODEV-NMXAJACMSA-N |
| XLogP | 5.72 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|