C20H20F3NO3 — CID 156694540
methyl 4-[(2S)-2-(hydroxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]benzoate (PubChem CID 156694540) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is methyl 4-[(2S)-2-(hydroxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(2S)-2-(hydroxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 156694540 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | methyl 4-[(2S)-2-(hydroxymethyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CC(c3ccc(C(F)(F)F)cc3)C[C@H]2CO)cc1 |
| InChI | InChI=1S/C20H20F3NO3/c1-27-19(26)14-4-8-17(9-5-14)24-11-15(10-18(24)12-25)13-2-6-16(7-3-13)20(21,22)23/h2-9,15,18,25H,10-12H2,1H3/t15?,18-/m0/s1 |
| InChIKey | VROPLOAVIFKFTB-PKHIMPSTSA-N |
| XLogP | 3.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |