C15H16F5NO3 — CID 166644106
(2S)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid (PubChem CID 166644106) has the molecular formula C15H16F5NO3 and a molecular weight of 353.29 g/mol. Its IUPAC name is (2S)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid.
| Compound Name | (2S)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 166644106 |
| Molecular Formula | C15H16F5NO3 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (2S)-2-(difluoromethoxymethyl)-5-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC(c2ccc(C(F)(F)F)cc2)CC[C@H]1COC(F)F |
| InChI | InChI=1S/C15H16F5NO3/c16-13(17)24-8-12-6-3-10(7-21(12)14(22)23)9-1-4-11(5-2-9)15(18,19)20/h1-2,4-5,10,12-13H,3,6-8H2,(H,22,23)/t10?,12-/m0/s1 |
| InChIKey | NLSXOPQFUZBDIF-KFJBMODSSA-N |
| XLogP | 4.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |