C10H8F3NO2 — CID 135081163
(2R)-1-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylic acid (PubChem CID 135081163) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is (2R)-1-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylic acid |
|---|---|
| PubChem CID | 135081163 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | (2R)-1-[4-(trifluoromethyl)phenyl]aziridine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)6-1-3-7(4-2-6)14-5-8(14)9(15)16/h1-4,8H,5H2,(H,15,16)/t8-,14?/m1/s1 |
| InChIKey | IRIYQXFJSFVTLK-ZSYIFEHUSA-N |
| XLogP | 1.98 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|