C19H18F3NO3 — CID 124917054
(2S,3R)-1-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 124917054) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is (2S,3R)-1-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R)-1-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124917054 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (2S,3R)-1-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(N2CC[C@@H](C(=O)O)[C@H]2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H18F3NO3/c1-26-15-8-6-14(7-9-15)23-11-10-16(18(24)25)17(23)12-2-4-13(5-3-12)19(20,21)22/h2-9,16-17H,10-11H2,1H3,(H,24,25)/t16-,17-/m1/s1 |
| InChIKey | DPKBRQZZZWDDNH-IAGOWNOFSA-N |
| XLogP | 4.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|