C25H14F3NO3 — CID 11618900
4-[4-[(Z)-[3,5-dioxo-4-[4-(trifluoromethyl)phenyl]oxolan-2-ylidene]methyl]phenyl]benzonitrile (PubChem CID 11618900) has the molecular formula C25H14F3NO3 and a molecular weight of 433.39 g/mol. Its IUPAC name is 4-[4-[(Z)-[3,5-dioxo-4-[4-(trifluoromethyl)phenyl]oxolan-2-ylidene]methyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[(Z)-[3,5-dioxo-4-[4-(trifluoromethyl)phenyl]oxolan-2-ylidene]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 11618900 |
| Molecular Formula | C25H14F3NO3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 4-[4-[(Z)-[3,5-dioxo-4-[4-(trifluoromethyl)phenyl]oxolan-2-ylidene]methyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(/C=C3\OC(=O)C(c4ccc(C(F)(F)F)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H14F3NO3/c26-25(27,28)20-11-9-19(10-12-20)22-23(30)21(32-24(22)31)13-15-1-5-17(6-2-15)18-7-3-16(14-29)4-8-18/h1-13,22H/b21-13- |
| InChIKey | RIEHCLPZAXKPGR-BKUYFWCQSA-N |
| XLogP | 5.49 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|