C28H10F12O4 — CID 146511854
4,8-bis(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,3,5,7-tetrone (PubChem CID 146511854) has the molecular formula C28H10F12O4 and a molecular weight of 638.36 g/mol. Its IUPAC name is 4,8-bis(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,3,5,7-tetrone.
| Compound Name | 4,8-bis(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 146511854 |
| Molecular Formula | C28H10F12O4 |
| Molecular Weight | 638.36 g/mol |
| Exact Mass | 638.04 |
| IUPAC Name | 4,8-bis(trifluoromethyl)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,3,5,7-tetrone |
| SMILES | O=C1c2c(c(C(F)(F)F)c3c(c2C(F)(F)F)C(=O)C(c2ccc(C(F)(F)F)cc2)C3=O)C(=O)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H10F12O4/c29-25(30,31)11-5-1-9(2-6-11)13-21(41)15-16(22(13)42)20(28(38,39)40)18-17(19(15)27(35,36)37)23(43)14(24(18)44)10-3-7-12(8-4-10)26(32,33)34/h1-8,13-14H |
| InChIKey | BEUROKXEXHLOHG-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.36 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|