C14H11Br2F3O — CID 102297627
(4S,5R)-5-bromo-3-(bromomethyl)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one (PubChem CID 102297627) has the molecular formula C14H11Br2F3O and a molecular weight of 412.04 g/mol. Its IUPAC name is (4S,5R)-5-bromo-3-(bromomethyl)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5R)-5-bromo-3-(bromomethyl)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 102297627 |
| Molecular Formula | C14H11Br2F3O |
| Molecular Weight | 412.04 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | (4S,5R)-5-bromo-3-(bromomethyl)-2-methyl-4-[4-(trifluoromethyl)phenyl]cyclopent-2-en-1-one |
| SMILES | CC1=C(CBr)[C@H](c2ccc(C(F)(F)F)cc2)[C@@H](Br)C1=O |
| InChI | InChI=1S/C14H11Br2F3O/c1-7-10(6-15)11(12(16)13(7)20)8-2-4-9(5-3-8)14(17,18)19/h2-5,11-12H,6H2,1H3/t11-,12+/m0/s1 |
| InChIKey | QNADOOANBJAUOX-NWDGAFQWSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.04 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|