C11H7F3N2O3 — CID 140521253
5-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 140521253) has the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 140521253 |
| Molecular Formula | C11H7F3N2O3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(c2ccc(C(F)(F)F)cc2)C(=O)N1 |
| InChI | InChI=1S/C11H7F3N2O3/c12-11(13,14)6-3-1-5(2-4-6)7-8(17)15-10(19)16-9(7)18/h1-4,7H,(H2,15,16,17,18,19) |
| InChIKey | OIXDMDFKVOTNJN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|