C14H13F3N4O3 — CID 74925714
1-methyl-5-[4-(trifluoromethyl)phenyl]-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 74925714) has the molecular formula C14H13F3N4O3 and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-methyl-5-[4-(trifluoromethyl)phenyl]-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-methyl-5-[4-(trifluoromethyl)phenyl]-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 74925714 |
| Molecular Formula | C14H13F3N4O3 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-methyl-5-[4-(trifluoromethyl)phenyl]-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | CN1C(=O)NC(=O)C2C(c3ccc(C(F)(F)F)cc3)NC(=O)NC21 |
| InChI | InChI=1S/C14H13F3N4O3/c1-21-10-8(11(22)20-13(21)24)9(18-12(23)19-10)6-2-4-7(5-3-6)14(15,16)17/h2-5,8-10H,1H3,(H2,18,19,23)(H,20,22,24) |
| InChIKey | RABLRKFWLGQZCF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |