C16H10F13NO — CID 162347991
4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxy-2-methyloctyl)benzonitrile (PubChem CID 162347991) has the molecular formula C16H10F13NO and a molecular weight of 479.24 g/mol. Its IUPAC name is 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxy-2-methyloctyl)benzonitrile.
| Compound Name | 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxy-2-methyloctyl)benzonitrile |
|---|---|
| PubChem CID | 162347991 |
| Molecular Formula | C16H10F13NO |
| Molecular Weight | 479.24 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-hydroxy-2-methyloctyl)benzonitrile |
| SMILES | CC(C(O)c1ccc(C#N)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H10F13NO/c1-7(10(31)9-4-2-8(6-30)3-5-9)11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h2-5,7,10,31H,1H3 |
| InChIKey | CJEKWOSKLKPWQV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.24 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|