C19H19F13O2 — CID 162348223
1-(2-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol (PubChem CID 162348223) has the molecular formula C19H19F13O2 and a molecular weight of 526.33 g/mol. Its IUPAC name is 1-(2-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol.
| Compound Name | 1-(2-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol |
|---|---|
| PubChem CID | 162348223 |
| Molecular Formula | C19H19F13O2 |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 1-(2-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctan-1-ol |
| SMILES | CCC(C)Oc1ccccc1C(O)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H19F13O2/c1-4-9(2)34-12-8-6-5-7-11(12)13(33)10(3)14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h5-10,13,33H,4H2,1-3H3 |
| InChIKey | PVBHSVWHPWSKQS-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|