C9H7F3N4 — CID 22341577
N'-(4-cyanoanilino)-2,2,2-trifluoroethanimidamide (PubChem CID 22341577) has the molecular formula C9H7F3N4 and a molecular weight of 228.18 g/mol. Its IUPAC name is N'-(4-cyanoanilino)-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-(4-cyanoanilino)-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 22341577 |
| Molecular Formula | C9H7F3N4 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N'-(4-cyanoanilino)-2,2,2-trifluoroethanimidamide |
| SMILES | N#Cc1ccc(N/N=C(\N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3N4/c10-9(11,12)8(14)16-15-7-3-1-6(5-13)2-4-7/h1-4,15H,(H2,14,16) |
| InChIKey | IRCYRJWISJXEIN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|