C9H7F2N3O — CID 170755835
2-(4-cyanophenyl)-2,2-difluoroacetohydrazide (PubChem CID 170755835) has the molecular formula C9H7F2N3O and a molecular weight of 211.17 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-2,2-difluoroacetohydrazide.
| Compound Name | 2-(4-cyanophenyl)-2,2-difluoroacetohydrazide |
|---|---|
| PubChem CID | 170755835 |
| Molecular Formula | C9H7F2N3O |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-(4-cyanophenyl)-2,2-difluoroacetohydrazide |
| SMILES | N#Cc1ccc(C(F)(F)C(=O)NN)cc1 |
| InChI | InChI=1S/C9H7F2N3O/c10-9(11,8(15)14-13)7-3-1-6(5-12)2-4-7/h1-4H,13H2,(H,14,15) |
| InChIKey | HVASQXOGQHTLRA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|