C10H9F2N3O2 — CID 107661575
2-(5-cyano-2-methylphenoxy)-2,2-difluoroacetohydrazide (PubChem CID 107661575) has the molecular formula C10H9F2N3O2 and a molecular weight of 241.20 g/mol. Its IUPAC name is 2-(5-cyano-2-methylphenoxy)-2,2-difluoroacetohydrazide.
| Compound Name | 2-(5-cyano-2-methylphenoxy)-2,2-difluoroacetohydrazide |
|---|---|
| PubChem CID | 107661575 |
| Molecular Formula | C10H9F2N3O2 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(5-cyano-2-methylphenoxy)-2,2-difluoroacetohydrazide |
| SMILES | Cc1ccc(C#N)cc1OC(F)(F)C(=O)NN |
| InChI | InChI=1S/C10H9F2N3O2/c1-6-2-3-7(5-13)4-8(6)17-10(11,12)9(16)15-14/h2-4H,14H2,1H3,(H,15,16) |
| InChIKey | BQHBILYVLYDVGQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|