C10H8F3N3 — CID 20713000
3-[(2Z)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile (PubChem CID 20713000) has the molecular formula C10H8F3N3 and a molecular weight of 227.19 g/mol. Its IUPAC name is 3-[(2Z)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile.
| Compound Name | 3-[(2Z)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile |
|---|---|
| PubChem CID | 20713000 |
| Molecular Formula | C10H8F3N3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-[(2Z)-2-(1,1,1-trifluoropropan-2-ylidene)hydrazinyl]benzonitrile |
| SMILES | C/C(=N/Nc1cccc(C#N)c1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3/c1-7(10(11,12)13)15-16-9-4-2-3-8(5-9)6-14/h2-5,16H,1H3/b15-7- |
| InChIKey | VJXWNAUCRDQKFI-CHHVJCJISA-N |
| XLogP | 2.91 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|