About 3-hydrazinylbenzonitrile chloride
3-hydrazinylbenzonitrile chloride (PubChem CID 18677448) has the molecular formula C7H7ClN3-
and a molecular weight of 168.61 g/mol. Its IUPAC name is 3-hydrazinylbenzonitrile chloride.
Molecular Properties
| Compound Name | 3-hydrazinylbenzonitrile chloride |
| PubChem CID | 18677448 |
| Molecular Formula | C7H7ClN3- |
| Molecular Weight | 168.61 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 3-hydrazinylbenzonitrile chloride |
| SMILES | N#Cc1cccc(NN)c1.[Cl-] |
| InChI | InChI=1S/C7H7N3.ClH/c8-5-6-2-1-3-7(4-6)10-9;/h1-4,10H,9H2;1H/p-1 |
| InChIKey | OLRXCKFWRROJFZ-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.61 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinylbenzonitrile chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinylbenzonitrile chloride?
The IUPAC name of 3-hydrazinylbenzonitrile chloride (CID 18677448) is 3-hydrazinylbenzonitrile chloride.
What is the SMILES notation for 3-hydrazinylbenzonitrile chloride?
The canonical SMILES for 3-hydrazinylbenzonitrile chloride is N#Cc1cccc(NN)c1.[Cl-].
What is the InChIKey of 3-hydrazinylbenzonitrile chloride?
The InChIKey is OLRXCKFWRROJFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7N3.ClH/c8-5-6-2-1-3-7(4-6)10-9;/h1-4,10H,9H2;1H/p-1.
What are the key properties of 3-hydrazinylbenzonitrile chloride?
3-hydrazinylbenzonitrile chloride has a molecular weight of 168.61 g/mol, XLogP of -2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinylbenzonitrile chloride is sourced from PubChem (CID 18677448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).